Guaifenesin

Synonyms :
Glyceryl guaiacolate, guaiphenesin, Hustosil, Robitussin

Status : approved

Category

Expectorants

Therapeutic Classification

EXPECTORANTS, EXCL. COMBINATIONS WITH COUGH SUPPRESSANTS

RESPIRATORY SYSTEM
COUGH AND COLD PREPARATIONS
EXPECTORANTS, EXCL. COMBINATIONS WITH COUGH SUPPRESSANTS

Description

An expectorant that also has some muscle relaxing action. It is used in many cough preparations. [PubChem]

Used

Used to assist the expectoration of phlegm from the airways in acute respiratory tract infections.

Mechanism Of Action

Guaifenesin may act as an irritant to gastric vagal receptors, and recruit efferent parasympathetic reflexes that cause glandular exocytosis of a less viscous mucus mixture. Cough may be provoked. This combination may flush tenacious, congealed mucopurulent material from obstructed small airways and lead to a temporary improvement in dyspnea or the work of breathing.

Dosage

Form Route Strength
Solution oral 15; 200; 30 mg/5mL; mg/5mL; mg/5mL
Solution oral 5; 50; 15 mg/5mL; mg/5mL; mg/5mL
Liquid oral 650; 20; 400; 10 1/20mL; mg/20mL; mg/20mL; mg/20mL
Powder, for solution oral 500; 20; 400; 10 mg/1; mg/1; mg/1; mg
Capsule, liquid filled oral 250; 10; 200; 5 mg/1; mg/1; mg/1; mg
Solution/ drops oral 5; 100; 2.5 mg/mL; mg/mL; mg/mL
Liquid oral 30; 200; 10 mg/5mL; mg/5mL; mg/5mL
Liquid oral 15; 150 mg/7.5mL; mg/7.5mL
Tablet oral 15; 400; 10 mg/1; mg/1; mg
Solution oral 100; 2.5 mg/5mL; mg/5mL
Solution oral 10; 100; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 200; 5 mg/5mL; mg/5mL
Tablet oral 15 mg
Syrup oral 15 mg
Capsule oral 10 mg
Solution oral 15 mg
Solution/ drops oral 5; 50; 2.5 mg/mL; mg/mL; mg/mL
Liquid oral 20; 200; 10 mg/5mL; mg/5mL; mg/5mL
Liquid oral 20; 400; 10 mg/5mL; mg/5mL; mg/5mL
Suspension/ drops oral 10; 200; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 15; 100; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 15; 300; 15 mg/5mL; mg/5mL; mg/5mL
Liquid oral 28; 388; 10 mg/5mL; mg/5mL; mg/5mL
Tablet oral 388; 10; 28 mg/1; mg/1; mg
Liquid oral 15; 200; 30 mg/5mL; mg/5mL; mg/5mL
Tablet oral 388; 10 mg/1; mg
Liquid oral 10; 187 mg/5mL; mg/5mL
Liquid oral 15; 25 mg/5mL; mg/5mL
Liquid oral 15; 200; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 5; 75; 2.5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 100; 10 mg/15mL; mg/15mL
Liquid oral 250; 13.33; 200; 5 mg/10mL; mg/10mL; mg/10mL; mg/10mL
Liquid oral 30; 200 mg/10mL; mg/10mL
Liquid oral 200; 20; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 15; 350; 10 mg/5mL; mg/5mL; mg/5mL
Solution/ drops oral 5; 100; 2.5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 20; 400 mg/5mL; mg/5mL
Liquid oral 15; 300; 10 mg/5mL; mg/5mL; mg/5mL
Liquid oral 30 mg
Tablet oral 15; 400; 60 mg/1; mg/1; mg
Tablet oral 30; 400; 30 mg/1; mg/1; mg
Liquid oral 10; 100; 30 mg/5mL; mg/5mL; mg/5mL
Liquid oral 100 mg
Liquid oral 10; 100; 5 mg/10mL; mg/10mL; mg/10mL
Liquid oral 325; 200; 10; 5 mg/10mL; mg/10mL; mg/10mL; mg/10mL
Solution oral 325; 10; 200; 5 mg/10mL; mg/10mL; mg/10mL; mg/10mL
Solution oral 100; 5 mg/5mL; mg/5mL
Granule oral 5; 100 mg/1; mg
Solution oral 5; 100; 2.5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 100; 5; 2.5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 5; 100 mg/5mL; mg/5mL
Liquid oral 5; 50; 2.5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 325; 10; 5; 200 mg/10mL; mg/10mL; mg/10mL; mg/10mL
Elixir oral 100 mg
Tablet oral 325; 15; 200; 5 mg/1; mg/1; mg/1; mg
Liquid oral 325; 200; 5 mg/15mL; mg/15mL; mg/15mL
Tablet, coated oral 325; 10; 100; 5 mg/1; mg/1; mg/1; mg
Capsule, liquid filled oral 325; 200; 10; 5 mg/1; mg/1; mg/1; mg
Tablet, film coated oral 325; 5; 200; 10 mg/1; mg/1; mg/1; mg
Tablet oral 325; 200; 10; 5 mg/1; mg/1; mg/1; mg
Tablet oral 325; 5; 200; 15 mg/1; mg/1; mg/1; mg
Tablet oral 325; 200; 5 1/1; 1/1; 1
Tablet oral 5; 325; 200 mg/1; mg/1; mg
Solution oral 30 mg
Tablet, film coated oral 400; 60 mg/1; mg
Tablet oral 5; 325; 10; 200 mg/1; mg/1; mg/1; mg
Tablet oral 5 mg
Capsule, gelatin coated oral 10; 200 mg/1; mg
Liquid oral 20; 400 mg/20mL; mg/20mL
Liquid oral 325; 10; 200; 5 mg/10mL; mg/10mL; mg/10mL; mg/10mL
Solution oral 10 mg
Syrup oral 30.0 mg
Suppository rectal .2 ml
Suppository rectal .4 ml
Tablet oral 20; 400 mg/1; mg
Liquid oral 325; 200; 10; 5 mg/5mL; mg/5mL; mg/5mL; mg/5mL
Capsule, liquid filled oral 325; 10; 6.25; 5 mg/1; mg/1; mg/1; mg
Capsule oral 390; 10 mg/1; mg
Capsule oral 15; 390; 10 mg/1; mg/1; mg
Tablet oral 15; 380; 10 mg/1; mg/1; mg
Tablet oral 380; 10 mg/1; mg
Solution oral 4; 50; 2.5 mg/mL; mg/mL; mg/mL
Powder, for solution oral 650; 20; 400; 10 mg/1; mg/1; mg/1; mg
Syrup oral 15; 100; 5 mg/5mL; mg/5mL; mg/5mL
Tablet oral 10; 200; 30 mg/1; mg/1; mg
Syrup oral 10; 100; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 5; 50; 2.5 mg/mL; mg/mL; mg/mL
Tablet oral 200; 30; 10 mg/1; mg/1; mg
Tablet oral 200; 30 mg/1; mg
Liquid oral 200; 10 mg/5mL; mg/5mL
Syrup oral 2 mg
Liquid oral 2 mg
Liquid oral 1.5; 20 mg/mL; mg/mL
Liquid oral 20; 300 mg/5mL; mg/5mL
Tablet oral 325; 100; 5 mg/1; mg/1; mg
Liquid oral 50; 2.5 mg/5mL; mg/5mL
Tablet, film coated oral 500; 20; 200; 60 mg/1; mg/1; mg/1; mg
Tablet oral 15; 395; 10 mg/1; mg/1; mg
Tablet oral 395; 10 mg/1; mg
Liquid oral 100; 5 mg/5mL; mg/5mL
Tablet (extended-release) oral 120 mg
Tablet (extended-release) oral 75 mg
Tablet oral 375; 60 mg/1; mg
Liquid oral 15; 175; 30 mg/5mL; mg/5mL; mg/5mL
Tablet oral 20; 400; 60 mg/1; mg/1; mg
Syrup oral 100 mg
Syrup oral 5 mg
Liquid oral 100; 10 mg/5mL; mg/5mL
Tablet oral 20 mg
Capsule, liquid filled oral 200; 35; 8; 5 mg/1; mg/1; mg/1; mg
Capsule, liquid filled oral 18.75; 8; 5; 35; 200 mg/1; mg/1; mg/1; mg/1; mg
Capsule, liquid filled oral 200; 35; 5; 8; 18.75 mg/1; mg/1; mg/1; mg/1; mg
Liquid oral 40; 400 mg/10mL; mg/10mL
Liquid oral 200; 2.5 mg/5mL; mg/5mL
Suspension oral 200; 10; 5 mg/5mL; mg/5mL; mg/5mL
Solution oral 15; 350; 10 mg/5mL; mg/5mL; mg/5mL
Solution/ drops nasal 5; 100; 2.5 mg/mL; mg/mL; mg/mL
Liquid oral 10; 200; 30 mg/5mL; mg/5mL; mg/5mL
Liquid oral 5; 50; 15 mg/5mL; mg/5mL; mg/5mL
Tablet oral 388; 28; 10 mg/1; mg/1; mg
Suspension oral 20; 400 mg/10mL; mg/10mL
Liquid oral 5; 100; 2.5 mg/5mL; mg/5mL; mg/5mL
Solution oral 5; 100 mg/5mL; mg/5mL
Tablet, coated oral 325; 10; 200; 5 mg/1; mg/1; mg/1; mg
Tablet, film coated oral 325; 10; 200; 5 mg/1; mg/1; mg/1; mg
Liquid oral 10; 200 mg/15mL; mg/15mL
Tablet, extended release oral 600 mg
Liquid oral 100 mg/5mL
Tablet, coated oral 325; 200; 5 mg/1; mg/1; mg
Solution oral 325; 10; 200; 5 mg/15mL; mg/15mL; mg/15mL; mg/15mL
Syrup oral 100 mg/5mL
Solution oral 20; 200 mg/10mL; mg/10mL
Liquid oral 20; 400 mg/10mL; mg/10mL
Syrup oral 200 mg/10mL
Liquid oral 10; 100 mg/15mL; mg/15mL
Liquid oral 300 mg/15mL
Solution oral 100 mg/5mL
Solution oral 100; 10 mg/5mL; mg/5mL
Syrup oral 200; 20 mg/10mL; mg/10mL
Solution oral 200; 10 mg/5mL; mg/5mL
Syrup oral 100; 10 mg/5mL; mg/5mL
Tablet, coated oral 400; 20; 10 mg/1; mg/1; mg
Solution oral 200 mg/10mL
Tablet oral 5; 325; 100 mg/1; mg/1; mg
Liquid oral 200; 2.5; 30 mg/5mL; mg/5mL; mg/5mL
Solution oral 10; 100 mg/5mL; mg/5mL
Syrup oral 200; 5 mg/5mL; mg/5mL
Tablet, orally disintegrating oral 100 mg
Solution oral 650; 400; 10 mg/20mL; mg/20mL; mg/20mL
Solution oral 650; 20; 400; 10 mg/20mL; mg/20mL; mg/20mL; mg/20mL
Solution oral 20; 400 mg/20mL; mg/20mL
Solution oral 20; 400; 10 mg/20mL; mg/20mL; mg/20mL
Syrup oral 20 mg
Liquid oral 20 mg
Liquid oral 5; 75 mg/5mL; mg/5mL
Liquid oral 5 g/100mL
Syrup oral 50 mg/5mL
Liquid oral 200 mg/5mL
Granule oral 100 mg
Liquid oral 7.5; 200 mg/5mL; mg/5mL
Liquid oral 6.33; 100 mg/5mL; mg/5mL
Syrup oral 7.5; 225 mg/5mL; mg/5mL
Tablet oral 400; 10; 20 mg/1; mg/1; mg
Tablet, coated oral 400; 10 mg/1; mg
Tablet, extended release oral 600; 60 mg/1; mg
Tablet, extended release oral 1200; 120 mg/1; mg
Tablet oral 600; 30 mg/1; mg
Tablet, extended release oral 1200; 60 mg/1; mg
Tablet, extended release oral 600; 30 mg/1; mg
Tablet (immediate and extended release) oral 600 mg
Capsule, liquid filled oral 325; 10; 200; 5 mg/1; mg/1; mg/1; mg
Tablet, coated oral 200; 5; 325; 10 mg/1; mg/1; mg/1; mg
Tablet, coated oral 200; 5; 10 mg/1; mg/1; mg
Tablet, extended release oral 1200 mg
Solution oral 100 mg
Tablet oral 400 mg
Tablet, film coated oral 400 mg
Tablet, coated oral 400 mg
Liquid oral 400; 650; 10 mg/20mL; mg/20mL; mg/20mL
Liquid oral 400; 20; 650; 10 mg/20mL; mg/20mL; mg/20mL; mg/20mL
Tablet, coated oral 20; 400 mg/1; mg
Tablet, film coated oral 400; 40 mg/1; mg
Capsule, liquid filled oral 400; 20 mg/1; mg
Tablet oral 400; 20 mg/1; mg
Tablet, film coated oral 20; 400 mg/1; mg
Liquid oral 400; 20 mg/20mL; mg/20mL
Tablet, film coated oral 400; 10 mg/1; mg
Liquid oral 20; 650; 400; 10 mg/20mL; mg/20mL; mg/20mL; mg/20mL
Liquid oral 20; 400; 10 mg/20mL; mg/20mL; mg/20mL
Liquid oral 400; 20; 10 mg/20mL; mg/20mL; mg/20mL
Tablet, film coated oral 10; 200; 5 mg/1; mg/1; mg
Tablet, film coated oral 325; 200; 5 mg/1; mg/1; mg
Tablet oral 400; 10 mg/1; mg
Tablet oral 325; 162; 200; 15 mg/1; mg/1; mg/1; mg
Liquid oral 20; 200; 10 mg/10mL; mg/10mL; mg/10mL
Liquid oral 20; 400; 10 mg/10mL; mg/10mL; mg/10mL
Syrup oral 1 mg
Liquid oral 8; 200 mg/5mL; mg/5mL
Tablet oral 380; 15; 10 mg/1; mg/1; mg
Tablet oral 325; 200; 5 mg/1; mg/1; mg
Tablet, film coated oral 200; 5 mg/1; mg
Syrup oral 20 mg
Liquid oral 7.5 mg
Solution oral 2.5; 200 mg/5mL; mg/5mL
Tablet oral 200 mg
Liquid oral 30; 2.77 mg/301; mg/301
Liquid oral 300; 2.5; 83.3 mg/30mL; mg/30mL; mg/30mL
Capsule, coated oral 325; 10; 100; 5 mg/1; mg/1; mg/1; mg
Solution oral 10; 187 mg/5mL; mg/5mL
Syrup oral 125; 15 mg/5mL; mg/5mL
Liquid oral 10; 187; 30 mg/5mL; mg/5mL; mg/5mL
Tablet, film coated oral 325; 15; 200; 5 mg/1; mg/1; mg/1; mg
Tablet oral 380; 20; 60 mg/1; mg/1; mg
Tablet oral 380; 60 mg/1; mg
Capsule oral 15 mg
Syrup oral 12.5 mg
Syrup oral 10; 100 mg/5mL; mg/5mL
Syrup oral 30 mg
Syrup oral 200 mg/5mL
Liquid oral 6.3; 100 mg/5mL; mg/5mL
Capsule oral 150; 30 mg/1; mg
Solution oral 100; 10; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 15 mg
Capsule, liquid filled oral 10; 200 mg/1; mg
Syrup oral 200 mg
Liquid oral 200 mg/10mL
Liquid oral 10; 100 mg/5mL; mg/5mL
Solution oral 20; 400 mg/10mL; mg/10mL
Liquid oral 10; 200; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 10; 100; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 650; 20; 400; 10 mg/20mL; mg/20mL; mg/20mL; mg/20mL
Liquid oral 2; 20 mg/mL; mg/mL
Solution oral 20; 200; 10 mg/10mL; mg/10mL; mg/10mL
Liquid oral 15; 200 mg/5mL; mg/5mL
Liquid oral 650; 20; 400; 10 mg/30mL; mg/30mL; mg/30mL; mg/30mL
Tablet, film coated oral 200; 5; 10 mg/1; mg/1; mg
Tablet oral 325; 200; 30 mg/1; mg/1; mg
Capsule, coated oral 325; 200; 5 mg/1; mg/1; mg
Tablet oral 325; 5; 200 mg/1; mg/1; mg
Liquid oral 650; 400; 10 mg/20mL; mg/20mL; mg/20mL
Syrup oral 15; 150 mg/7.5mL; mg/7.5mL
Syrup oral 30; 200 mg/10mL; mg/10mL
Tablet oral 15; 100; 5 mg/1; mg/1; mg
Syrup oral 50; 5 mg/mL; mg/mL
Syrup oral 50; 5; 2.5 mg/mL; mg/mL; mg/mL
Solution/ drops oral 50; 2.5 mg/mL; mg/mL
Powder, for solution oral 1000; 400 mg/1; mg
Powder, for solution oral 1000; 30; 400; 60 mg/1; mg/1; mg/1; mg
Syrup oral 325; 200; 5 mg/15mL; mg/15mL; mg/15mL
Suspension oral 325; 10; 200; 5 mg/15mL; mg/15mL; mg/15mL; mg/15mL
Suspension oral 20; 400; 10 mg/10mL; mg/10mL; mg/10mL
Liquid oral 2.5 mg
Syrup oral 50; 2.5 mg/5mL; mg/5mL
Capsule oral 30 mg
Syrup oral 7.5 mg
Liquid oral 8; 200; 30 mg/5mL; mg/5mL; mg/5mL
Syrup oral 20; 400; 10 mg/5mL; mg/5mL; mg/5mL
Tablet oral 30; 400; 60 mg/1; mg/1; mg
Solution/ drops oral 25; 7.5; 2.5 mg/mL; mg/mL; mg/mL
Solution/ drops oral 25; 7.5 mg/mL; mg/mL
Syrup oral 200; 5; 10 mg/5mL; mg/5mL; mg/5mL
Syrup oral 75; 2.5; 5 mg/5mL; mg/5mL; mg/5mL
Liquid oral 20; 200 mg/10mL; mg/10mL
Syrup oral 28; 388; 10 mg/5mL; mg/5mL; mg/5mL
Solution/ drops oral 7.5; 88; 2.5 mg/mL; mg/mL; mg/mL
Tablet oral 28; 388; 10 1/1; 1/1; 1
Tablet oral 325 mg
Powder for solution oral 30 mg
Liquid oral 18; 200; 10 mg/15mL; mg/15mL; mg/15mL
Syrup oral 10 mg
Liquid oral 20 mg
Tablet oral 10 mg
Liquid oral 200 mg
Tablet oral 325; 10; 200; 5 mg/1; mg/1; mg/1; mg
Liquid oral 10 mg
Liquid oral 10; 200 mg/5mL; mg/5mL
Tablet, film coated oral 325; 10; 100; 5 mg/1; mg/1; mg/1; mg
Tablet oral 200; 5 mg/1; mg
Liquid oral 325; 10; 200; 5 mg/15mL; mg/15mL; mg/15mL; mg/15mL
Liquid oral 9; 200; 30 mg/5mL; mg/5mL; mg/5mL
Liquid oral 325; 10; 200 mg/15mL; mg/15mL; mg/15mL
Suspension oral 15; 3; 60 mg/3mL; mg/3mL; mg/3mL
Suspension oral 15.001; 3.5; 70 mg/3.5mL; mg/3.5mL; mg/3.5mL
Suspension oral 14.998; 4.5; 90 mg/4.5mL; mg/4.5mL; mg/4.5mL
Suspension oral 30; 5; 100 mg/5mL; mg/5mL; mg/5mL
Suspension oral 30; 7.5; 150 mg/7.5mL; mg/7.5mL; mg/7.5mL
Suspension oral 30; 10; 200 mg/10mL; mg/10mL; mg/10mL
Syrup oral 20; 400 mg/5mL; mg/5mL

Pharmacodynamics

Guaifenesin is an expectorant which increases the output of phlegm (sputum) and bronchial secretions by reducing adhesiveness and surface tension. The increased flow of less viscous secretions promotes ciliary action and changes a dry, unproductive cough to one that is more productive and less frequent. By reducing the viscosity and adhesiveness of secretions, guaifenesin increases the efficacy of the mucociliary mechanism in removing accumulated secretions from the upper and lower airway.

Toxic Effect

LD50 1510 mg/kg (rat, oral)

Metabolism

Rapidly hydrolyzed (60% within seven hours) and then excreted in the urine, with beta-(2-methoxyphenoxy)-lactic acid as its major urinary metabolite.

Absorption

Rapidly absorbed from the GI tract

Half Life

1 hour

Chemical Classification

This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof.

Anisoles

Organic compounds

Benzenoids

Benzene and substituted derivatives

Phenol ethers

Chemical Name

Glyceryl guaiacolate

Brands

name Dosage form Country
7 Select Mucus Relief tablet, extended release US
Acetaminophen, Dextromethorphan Hydrobromide, Guaifenesin, Phenylephrine Hydrochloride tablet, coated US
Acetaminophen, Dextromethorphan Hydrobromide, Guaifenesin, Phenylephrine Hydrochloride tablet, coated US
Acetaminophen, Dextromethorphan Hydrobromide, Guaifenesin, Phenylephrine Hydrochloride tablet, coated US
Acetaminophen, Dextromethorphan Hydrobromide, Guaifenesin, Phenylephrine Hydrochloride tablet, coated US
Acetaminophen, Guaifenesin, Phenylephrine Hydrochloride tablet, coated US
Actinel solution US
Actinel Pediatric solution US
Adult Cf Cough liquid US
Adult Cold, Flu and Sore Throat liquid US
Adult Cold, Flu and Sore Throat liquid US
Adult Cough and Chest Congestion Relief Dm Non Drowsy liquid US
Adult Severe Congestion and Cough liquid US
Adult Severe Congestion and Cough liquid US
Adult Tussin syrup US
Adult Tussin chest congestion syrup US
Adult Tussin Cough and Chest Congestion Dm liquid US
Adult Tussin Cough and Chest Congestion Dm Sugar Free liquid US
Adult Tussin Cough and Chest Congestion Dm Sugar Free liquid US
Adult Tussin Cough and Cold Cf liquid US
Adult Tussin Dm Lil Drug Store Products liquid US
Adult Tussin Dm Max liquid US
Adults Tussin Dm solution US
Air Power tablet US
Air-power tablet Canada
Alka-seltzer Plus Day Severe Cold Plus Flu powder, for solution US
Alka-seltzer Plus Max Cough, Mucus and Congestion capsule, liquid filled US
Alka-seltzer Plus Severe Cold, Mucus and Congestion capsule, liquid filled US
Alka-seltzer Plus Severe Cough Mucus and Congestion Liquid Gels capsule, liquid filled US
Alka-seltzer Plus Severe Sinus Cold and Cough Liquid Gels capsule, liquid filled US
Allfen Dm tablet US
Alticotron solution/ drops US
Altidesp solution/ drops US
Altidome DMX liquid US
Altipres liquid US
Altipres Pediatric liquid US
Altituss liquid US
Aquanaz tablet US
Aspirin Free Cold Head Congestion Day Time tablet, coated US
Auromucus – Childrens Chest Congestion solution US
Auromucus – Childrens Cough solution US
Auromucus – Childrens Multi-symptom Cold solution US
Auromucus – Childrens Stuffy Nose and Cold solution US
Auromucus – Childrens Stuffy Nose and Cold solution US
Auromucus – Fast Maximum Cold and Sinus solution US
Auromucus – Fast Maximum Cold, Flu and Sore Throat Relief solution US
Auromucus – Fast Maximum Dm Max solution US
Auromucus – Fast Maximum Severe Congestion and Cough solution US
Aurophen Cold and Flu Severe liquid US
Aurophen Cold Multi-symptom Severe liquid US
Auroquil Severe Cold and Flu Daytime Relief solution US
Aurotussin Mucus Plus Chest Congestion (original) liquid US
Aurotussin Peak Cold Cough Plus Chest Congestion Dm liquid US
Aurotussin Peak Cold Maximum Strength Cough Plus Chest Congestion Dm liquid US
Aurotussin Peak Cold Multi-symptom Cold liquid US
Aurotussin Peak Cold Sugar-free Cough Plus Chest Congestion Dm liquid US
Bactimicina Cough and Cold solution US
Baczol Expectorant liquid US
Balminil Codeine + Decongestant + Expectorant liquid Canada
Balminil Cough and Flu syrup Canada
Balminil DM + Decongestant + Expectorant syrup Canada
Balminil DM + Decongestant + Expectorant Extra Strength syrup Canada
Balminil DM + Expectorant syrup Canada
Balminil DM + Expectorant Extra Strength syrup Canada
Balminil DM-d-e – Liq liquid Canada
Balminil Expectorant syrup Canada
Balminil Expectorant (sucrose Free) syrup Canada
Balminil Expectorant Liq 100mg/5ml liquid Canada
Being Well Adult Cough Relief Dm solution US
Benylin 1 Nightime With Menthactin liquid Canada
Benylin 1 With Menthactin liquid Canada
Benylin 2 Cold and Flu With Codeine syrup Canada
Benylin 4 Flu – Syrup syrup Canada
Benylin All-in-one Cold and Flu Extra Strength tablet Canada
Benylin All-in-one Cold and Flu Extra Strength Syrup syrup Canada
Benylin All-in-one Cold and Flu Liquid Gels capsule Canada
Benylin All-in-one Cold and Flu Night Extra Strength Syrup syrup Canada
Benylin All-in-one Cold and Flu Pe Caplets tablet Canada
Benylin Chest Congestion Extra Strength syrup Canada
Benylin Codeine 3.3mg De Syr syrup Canada
Benylin Cough & Chest Congestion for People With Diabetes syrup Canada
Benylin Cough & Congestion Extra Strength syrup Canada
Benylin Cough and Chest Congestion Extra Strength With Warming Sensation syrup Canada
Benylin Cough and Cold syrup Canada
Benylin Cough and Congestion syrup Canada
Benylin Cough Plus Cold Relief syrup Canada
Benylin DM-d-e solution Canada
Benylin DM-d-e Extra Strength With Menthactin syrup Canada
Benylin DM-d-e With Menthactin liquid Canada
Benylin DM-d-e-a Cold and Sinus Liquid Gels capsule Canada
Benylin DM-e Menthol Extra Strength Cough and Chest Congestion syrup Canada
Benylin DM-e Syr syrup Canada
Benylin E Menthol Extra Strength syrup Canada
Benylin E Syrup syrup Canada
Benylin Extra Strength All-in-one Cold and Flu syrup Canada
Benylin Extra Strength All-in-one Cold and Flu Nightime syrup Canada
Benylin Extra Strength All-in-one Cold and Flu With Warming Sensation syrup Canada
Benylin Extra Strength Cough Plus Cold Relief syrup Canada
Benylin Extra Strength Mucus & Phlegm solution Canada
Benylin Extra Strength Mucus & Phlegm Plus Cold Relief syrup Canada
Benylin Extra Strength Mucus & Phlegm Plus Cold Relief tablet Canada
Benylin Extra Strength Mucus & Phlegm Plus Cold Relief Night syrup Canada
Benylin Extra Strength Mucus & Phlegm Plus Cough Control solution Canada
Benylin Extra Strength With Menthactin solution Canada
Berkley and Jensen Adult Tussin Dm liquid US
Berkley and Jensen Mucus Relief tablet, extended release US
Berkley and Jensen Tussin cough and chest congestion dm solution US
Bidex-400 tablet US
Bio-s-pres DX solution/ drops US
Bio-z-cough liquid US
Biobron DX liquid US
Biobron SF liquid US
Biocof liquid US
Biocotron – liquid US
Biocotron PED liquid US
Biocotron-d suspension/ drops US
Biodesp DM liquid US
Biodesp DM NF liquid US
Biogtuss liquid US
Biogtuss NF liquid US
Biogtuss TR tablet US
Bionel liquid US
Bionel Pediatric liquid US
Biophex TR tablet US
Biospec DMX liquid US
Biospec DMX liquid US
Biotpres liquid US
Biotpres Pediatric liquid US
Bisolvine Adult liquid US
Bisolvine Child liquid US
Breacold Adult liquid US
Breacold Children liquid US
Bronchophan Expectorant (sans Sucrose) syrup Canada
Bronco Pulmonar Syrup liquid US
Broncomar liquid US
Broncomar DM liquid US
Broncomar Maximum liquid US
Broncomar SF liquid US
Broncotron liquid US
Broncotron D liquid US
Broncotron Ped liquid US
Broncotron Ped solution/ drops US
Broncotron S liquid US
Bronkisan liquid US
Brontuss DX liquid US
Brontuss SF liquid US
Brontuss SF-NR liquid US
Buckley’s Complete Daytime Plus Mucus Relief Softgels capsule Canada
Buckley’s Complete Plus Mucous Relief liquid Canada
Buckley’s Complete Plus Mucous Relief Extra Strength liquid Canada
Buckley’s Cough Chest Congestion syrup Canada
Buckley’s Cough, Mucous & Phlegm liquid Canada
Calmylin #3 Syr syrup Canada
Calmylin Codeine D-e Syr syrup Canada
Calmylin Cough and Flu Liq liquid Canada
Calmylin Expectorant Syr 100mg/5ml syrup Canada
Calmylin Pse With Codeine liquid Canada
Capmist Dm tablet US
Capmist DM tablet US
Care One Chest Congestion Relief DM tablet US
Care One Cold Head Congestion tablet, coated US
Careone Adult Tussin syrup US
Careone Adult Tussin Cf solution US
Careone Adult Tussin Dm solution US
Careone Adult Tussin Dm solution US
Careone Adult Tussin Dm sugar free solution US
Careone Childrens Mucus Relief solution US
Careone Childrens Mucus Relief solution US
Careone Daytime Severe Cold Flu Relief solution US
Careone Mucus Er tablet, extended release US
Careone Mucus Relief tablet, film coated US
Careone Mucus Relief tablet, film coated US
Careone Mucus Relief childrens solution US
Careone Mucus Relief Cold and Sinus tablet, coated US
Careone Mucus Relief Severe Congestion and Cold tablet, film coated US
Careone Severe Sinus Congestion and Pain tablet, coated US
Cheracol D Cough Formula 4oz syrup US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Ac liquid US
Cheratussin Dac liquid US
Chest Congestion liquid Canada
Chest Congestion solution US
Chest Congestion syrup Canada
Chest Congestion liquid US
Chest Congestion solution US
Chest Congestion childrens solution US
Chest Congestion childrens plus cough solution US
Chest Congestion Relief tablet US
Chest Congestion Syrup syrup Canada
Chest Congestion, Cough & Cold Syrup syrup Canada
Chest Congestion, Cough & Cold Syrup Extra Strength syrup Canada
Children’s Mucinex Chest Congestion Liquid liquid Canada
Childrens Aurotussin Cough and Chest Congestion Dm liquid US
Childrens Aurotussin Cough and Cold Cf liquid US
Childrens Chest Congestion solution US
Childrens Chest Congestion Relief liquid US
Childrens Chest Congestion Relief Grape liquid US
Childrens Cold, Cough and Sore Throat liquid US
Childrens Cough and Chest Congestion Dm liquid US
Childrens Cough and Cold Cf liquid US
Childrens Delsym Cough Plus Chest Congestion DM solution US
Childrens Delsym Cough Plus Cold Day Time solution US
Childrens Mucinex Chest Congestion liquid US
Childrens Mucinex Chest Congestion solution US
Childrens Mucinex Chest Congestion solution US
Childrens Mucinex Cold, Cough and Sore Throat solution US
Childrens Mucinex Congestion and Cough solution US
Childrens Mucinex Congestion and Cough solution US
Childrens Mucinex Cough liquid US
Childrens Mucinex Cough solution US
Childrens Mucinex Cough solution US
Childrens Mucinex Mini-Melts Chest Congestion granule US
Childrens Mucinex Mini-Melts Cough granule US
Childrens Mucinex Multi-symptom Cold solution US
Childrens Mucinex Multi-Symptom Cold and Fever solution US
Childrens Mucinex Stuffy Nose and Cold solution US
Childrens Mucus Relief solution US
Childrens Mucus Relief solution US
Childrens Mucus Relief liquid US
Childrens Mucus Relief liquid US
Childrens Mucus Relief solution US
Childrens Mucus Relief solution US
Childrens Mucus Relief Cherry liquid US
Childrens Mucus Relief Cough liquid US
Childrens Mucus Relief Cough liquid US
Childrens Mucus Relief Cough Cherry liquid US
Childrens Mucus Relief Cough Cherry liquid US
Childrens Mucus Relief Dm liquid US
Childrens Mucus Relief Expectorant Grape liquid US
Childrens Mucus Relief Multi Symptom Cold liquid US
Childrens Mucus Relief Multi Symptom Cold solution US
Childrens Mucus Relief Multi-symptom Cold liquid US
Childrens Multi Symptom Cold solution US
Childrens Multi Symptom Cold solution US
Childrens Multi-symptom Cold liquid US
Childrens Multi-symptom Cold liquid US
Childrens Multi-symptom Cold and Fever Relief liquid US
Childrens Relief Cherry liquid US
Childrens Robitussin Cough and Chest Congestion Dm liquid US
Childrens Robitussin Cough and Cold Cf liquid US
Childrens Stuffy Nose and Cold solution US
Childrens Tussnex liquid US
Childrens Tussnex Multi-symptom Cold liquid US
Childrensrelief Expectorant Grape liquid US
Choledyl Expectorant Elixir elixir Canada
Circle K Cold tablet US
Circle K Multi-symptom Sinus Relief tablet US
Coactifed syrup Canada
Codar GF liquid US
Codeine-guaifenesin solution US
Cold & Flu capsule Canada
Cold & Flu Relief Syrup syrup Canada
Cold & Sinus Liquid Fastgels capsule Canada
Cold and Chest Congestion Relief liquid US
Cold and Cough tablet, coated US
Cold and Cough Pe tablet, coated US
Cold and Cough Sinus Relief Pe NON-DROWSY tablet, coated US
Cold and Flu Capsules capsule Canada
Cold and Flu DAYTIME MAXIMUM STRENGTH NON-DROWSY SEVERE capsule, liquid filled US
Cold and Flu Extra Strength Day tablet Canada
Cold and Flu Nighttime Relief Syrup Extra Strength syrup Canada
Cold and Flu Relief Severe tablet US
Cold and Flu Severe tablet, film coated US
Cold and Flu Severe tablet, coated US
Cold and Flu Severe tablet, coated US
Cold and Flu Severe tablet, coated US
Cold and Flu severe tablet, film coated US
Cold and Flu Severe tablet, film coated US
Cold and Flu Severe tablet, coated US
Cold and Flu Severe tablet, film coated US
Cold and Flu Severe tablet, coated US
Cold and Flu-in-one Extra Strength tablet Canada
Cold and Flu-in-one Regular Strength tablet Canada
Cold and Head Congestion Relief Severe tablet US
Cold and Head Congestion Severe/Daytime tablet, film coated US
Cold and Sinus Complete Liquid Gels capsule Canada
Cold and Sinus Maximum Strength tablet, film coated US
Cold and Sinus Maximum Strength, Multi-Symptom tablet, film coated US
Cold and Sinus Pe Pressure, Pain and Cold Non-Drowsy tablet, coated US
Cold and Sinus Relief capsule Canada
Cold Chest Congestion Pe Regular Strength tablet Canada
Cold Flu and Sore Throat Relief Maximum Strength liquid US
Cold Head Congestion Non-Drowsy tablet, film coated US
Cold Head Congestion Severe tablet, film coated US
Cold head congestion severe tablet, coated US
Cold Medication Daytime Relief tablet Canada
Cold multi symptom severe tablet, film coated US
Cold Multi-symptom tablet, film coated US
Cold Multi-symptom Day-time tablet US
Cold Multi-symptom Severe tablet, coated US
Cold Multi-symptom Severe Day Time tablet, film coated US
Cold pain relief tablet, coated US
Cold Relief tablet, coated US
Cold Relief tablet, film coated US
Cold Relief daytime tablet, coated US
Cold Relief head congestion tablet, coated US
Cold Relief multi symptom tablet, film coated US
Cold Relief Multi Symptom Severe liquid US
Cold Relief severe tablet, film coated US
Cold Relief Severe Head Congestion tablet, coated US
Cold Relief Severe Pain Cough tablet US
Cold Relief severe, multi-symptom tablet, film coated US
Cold Tabs Ii tablet US
Cold Terminator Max tablet US
Cold, Flu and Sore Throat Maximum Strength tablet, film coated US
Cold, Flu and Sore Throat Maxium Strength liquid US
Complete Daytime Liquid Capsules capsule Canada
Complete One Cold and Flu Extra Strength solution Canada
Complete One Cold and Flu Extra Strength Tablets tablet Canada
Complete One Cold and Flu Nightime Extra Strength Liquid liquid Canada
Congestac tablet, film coated US
Conrx Cold tablet US
Conrx Cold tablet US
Conrx Daytime tablet US
Conrx Sinus tablet US
Conrx Sinus tablet US
Contac Cold Chest Congestion tablet Canada
Contac Complete Cough, Cold & Flu Syrup syrup Canada
Contac Cough & Cold Syrup syrup Canada
Coricidin Hbp Chest Congestion and Cough capsule, gelatin coated US
Coricidin II Chest Congestion and Cough capsule Canada
Cosedal Drops liquid US
Cough liquid US
Cough syrup US
Cough liquid US
Cough liquid US
Cough liquid US
Cough & Chest Congestion syrup Canada
Cough & Chest Congestion Extra Strength syrup Canada
Cough & Chest Congestion Liquid solution Canada
Cough & Cold Relief syrup Canada
Cough & Cold Relief Extra Strength syrup Canada
Cough & Cold Soft Gel Caps capsule Canada
Cough and Chest Congestion liquid US
Cough and Chest Congestion liquid US
Cough and Chest Congestion Dm solution US
Cough and Chest Congestion Dm Max solution US
Cough and Chest Congestion Dm Maximum Strength liquid US
Cough and Chest Congestion Syrup syrup Canada
Cough and Chest Congestion Syrup Extra Strength syrup Canada
Cough and Flu Syrup syrup Canada
Cough Be Gone liquid US
Cough Childrens solution US
Cough childrens mucus relief liquid US
Cough Cold and Sore Throat Childrens liquid US
Cough Control solution Canada
Cough Control Dm Max liquid US
Cough Control Dm Sugar Free liquid US
Cough Control Extra Strength syrup Canada
Cough Formula Cough and Cold liquid US
Cough Out liquid US
Cough Plus Chest Congestion adult dm max suspension US
Cough Syr W.cod. Pseudoephed.hcl Guaifenesin syrup Canada
Cough Syrup liquid US
Cough Syrup liquid US
Cough Syrup Dm syrup US
Cough Syrup DM – Decongestant – Expectorant syrup Canada
Cough Syrup DM – Decongestant – Expectorant Extra Strength syrup Canada
Cough Syrup DM Decongestant and Expectorant With Acetaminophen syrup Canada
Cough Syrup DM Decongestant and Expectorant With Acetaminophen Extra Strength syrup Canada
Cough Syrup DM Decongestant Expectorant liquid Canada
Cough Syrup DM Decongestant Expectorant syrup Canada
Cough Syrup DM Decongestant Expectorant syrup Canada
Cough Syrup DM Decongestant Expectorant syrup Canada
Cough Syrup DM Expectorant syrup Canada
Cough Syrup DM Expectorant syrup Canada
Cough Syrup DM Expectorant syrup Canada
Cough Syrup DM Expectorant Extra Strength liquid Canada
Cough Syrup DM-d-e syrup Canada
Cough Syrup DM-d-e With Acetaminophen syrup Canada
Cough Syrup DM-d-e With Acetaminophen Extra Strength syrup Canada
Cough Syrup DM-decongestant Expectorant liquid Canada
Cough Syrup DM-decongestant-expectorant Extra Strength liquid Canada
Cough Syrup DM-e syrup Canada
Cough Syrup DM-expectorant syrup Canada
Cough Syrup E 100mg/5ml syrup Canada
Cough Syrup Expectorant syrup Canada
Cough Syrup Expectorant syrup Canada
Cough Syrup Expectorant syrup Canada
Cough Syrup With Codeine syrup Canada
Cough Syrup With Codeine syrup Canada
Cough Syrup With Codeine syrup Canada
Cough tussin liquid US
Counteract Cough syrup US
Counteract Cough Medicine – Liq liquid Canada
Counteract Day tablet, film coated US
Creo Grippe Enfants Sup suppository Canada
Creo Grippe Sup Adultes suppository Canada
Cvs – Childrens Stuffy Nose and Cold solution US
Cvs Chest Congestion Relief DM tablet US
Day Relief liquid US
Day Time Cold Head Congestion Severe tablet, coated US
Day Time Cold Multi-symptom Cool Blast liquid US
Day Time Severe tablet, film coated US
Dayquil Liquicaps capsule Canada
Dayquil Severe Cold and Flu tablet US
Daytime liquid US
Daytime liquid US
Daytime Cold & Flu Liquid Capsules capsule Canada
Daytime Cold and Flu tablet, film coated US
Daytime Cold and Flu solution US
Daytime Cold and Pain Relief tablet, coated US
Daytime Cold Medication Liquid Fastgels capsule Canada
Daytime Cold Relief multi symptom tablet, film coated US
Daytime Cough. Cold. Flu Gel Capsules capsule Canada
Daytime Liquid – Liq liquid Canada
Daytime Relief Severe Cold and Flu solution US
Daytime Severe solution US
Daytime Severe cold and flu tablet, film coated US
Daytime Severe Cold and Flu solution US
Daytime Severe Cold and Flu capsule, liquid filled US
Daytime Severe Cold and Flu Relief tablet, film coated US
Daytime Severe Cold and Flu Relief solution US
Daytime Severe Cold and Flu Relief solution US
Daytime Severe Cold and Flu Relief Maximum Strength tablet, coated US
Daytime Severe Cold multi-symptom tablet, film coated US
Daytime Sinus Congestion and Pain tablet US
Deconex capsule US
Deconex DM capsule US
Deconex DMX tablet US
Deconex IR tablet US
Defensol Adult Syrup liquid US
Defensol-ito solution US
Defensolito Children Syrup liquid US
Delsym Cough Plus Chest Congestion DM solution US
Delsym Cough Plus Cold Day Time solution US
Delsym Cough Plus Cold Day Time powder, for solution US
Desgen Dm syrup US
Desgen Dm solution US
Desgen Dm Tabs tablet US
Desgen Pediatric solution/ drops US
Despec liquid US
Despec DM syrup US
Despec EDA Drops liquid US
Despec-dm Tabs tablet US
Despec-tab tablet US
Dextromethorphan Hbr and Guaifenesin solution US
Dg Health Childrens Mucus Relief solution US
Dg Health Childrens Mucus Relief Cough solution US
Dg Health Cold and Flu Relief suspension US
Dg Health Cold and Flu Relief Daytime tablet, film coated US
Dg Health Cold and Flu Severe tablet, coated US
Dg Health Cold Head Congestion Severe day time tablet, coated US
Dg Health Cold Multi Symptom severe tablet, film coated US
Dg Health Fast Acting Mucus Relief Severe Cold tablet, film coated US
Dg Health Fast Acting Mucus Relief Severe Congestion and Cold tablet, film coated US
Dg Health Mucus Er tablet, extended release US
Dg Health Mucus Relief tablet, coated US
Dg Health Mucus Relief tablet, film coated US
Dg Health Mucus Relief tablet, film coated US
Dg Health Mucus Relief Er tablet, extended release US
Dg Health Tussin Cf adult cough and cold solution US
Dg Health Tussin Dm adult solution US
Diabetic Maximum Strength Siltussin Dm Das-na liquid US
Diabetic Siltussin Das-na liquid US
Diabetic Siltussin Das-na liquid US
Diabetic Siltussin Dm Das-na liquid US
Diabetic Siltussin Dm Das-na liquid US
Diabetic Tussin Dm liquid US
Diabetic Tussin Dm Maximum Strength liquid US
Diabetic Tussin Expectorant liquid US
Dimetane Expectorant C syrup Canada
Dimetane Expectorant Dc syrup Canada
Dimetane Expectorant Liq liquid Canada
Dimetane Expectorant-c Syr syrup Canada
Dimetane Expectorant-dc Syr syrup Canada
Dimetapp Cough & Congestion Liquid liquid Canada
DM + Expectorant Extra Strength Syrup syrup Canada
DM + Expectorant Syrup syrup Canada
DM Cough Syrup Antitussive and Expectorant liquid Canada
DM Expectorant (extra Strength) Syrup syrup Canada
DM Expectorant Cough Syrup syrup Canada
Dm Max Maxium Strength liquid US
Dm Max Relief Maximum Strength liquid US
DM Plus Decongestant Plus Expector.ex.st.syr syrup Canada
DM Plus Decongestant Plus Expectorant Cough Syrup syrup Canada
DM Plus Expectorant Syrup syrup Canada
DM-d-expectorant Cough and Cold Syrup liquid Canada
DM-decongestant-expectorant (extra Strength) Syrup syrup Canada
DM-decongestant-expectorant Syrup syrup Canada
DM-expectorant Syrup syrup Canada
Donatussin Drops liquid US
Double Tussin Intense Cough Reliever DM liquid US
Dover Coldonyl tablet US
Dr. Cocoa Mucus Relief liquid US
Duraflu tablet, film coated US
Duravent Dm tablet US
Duravent Pe tablet US
Ed Bron Gp liquid US
Entex La tablet (extended-release) Canada
Entex La tablet (extended-release) Canada
Entex La Tablets Srt tablet (extended-release) Canada
Entex Lq liquid US
Entex T tablet US
Entre-cough liquid US
Equaline Adult Tussin cough and chest congestion liquid US
Equaline Daytime Severe Cold and Flu Relief solution US
Equaline Mucus Er tablet, extended release US
Equaline Mucus Relief tablet, film coated US
Equaline Mucus Relief tablet, film coated US
Equaline Tussin adult solution US
Equaline Tussin chest congestion syrup US
Equaline Tussin Cough and Chest Congestion dm max solution US
Equaline Tussin Cough and Cold liquid US
Equaline Tussin Mucus and Chest Congestion syrup US
Equaline Tussin multi symptom solution US
Equate Daytime Severe tablet, film coated US
Equate Mucus Er tablet, extended release US
Equate Tussin Adult Chest Congestion syrup US
Equate Tussin Cf liquid US
Equate Tussin Dm adult solution US
Equate Tussin Dm Max solution US
Exefen Dmx tablet US
Expectorant liquid Canada
Expectorant tablet US
Expectorant (extra Strength) Syrup syrup Canada
Expectorant (regular Strength) Cough Syrup syrup Canada
Expectorant 12 Hour tablet, extended release US
Expectorant Cough childrens liquid US
Expectorant Cough Formula Syr 100mg/5ml syrup Canada
Expectorant Cough Syrup 100mg/5ml syrup Canada
Expectorant Cough Syrup 100mg/5ml syrup Canada
Expectorant DM Cough Extra Strength syrup Canada
Expectorant DM Cough Extra Strength With Decongestant syrup Canada
Expectorant DM Cough Syrup syrup Canada
Expectorant Plus Cough Relief granule US
Expectorant Syrup syrup Canada
Expectorant Syrup (sucrose Free) syrup Canada
Expectorant Syrup Extra Strength syrup Canada
Expectorant Tab Dm tablet US
Expectorant-decongestant Syrup syrup Canada
Extra Action Cough liquid US
Extra Strength Cough Syrup Expectorant liquid Canada
Extra Strength E (expectorant Syrup) syrup Canada
Extra Strength Mucous Relief Chest tablet Canada
Extra Strength Mucous Relief Cough tablet Canada
Extra Strength Neocitran Cold Syrup With Mucus Relief syrup Canada
Extra Strength Tylenol Complete Cold, Cough & Flu tablet Canada
Extra Strength Tylenol Complete Cold, Cough & Flu Daytime tablet Canada
Extra Strength Tylenol Complete Cold, Cough & Flu Plus Mucus Relief syrup Canada
Extra Strength Tylenol Complete Cold, Cough & Flu Plus Mucus Relief Nighttime syrup Canada
Extra Strength Tylenol Congested Cough Caplets tablet Canada
Facol Cold and Flu Day capsule, liquid filled US
Facol Cold and Flu Day and Night capsule, liquid filled US
Facol Cold and Flu Night capsule, liquid filled US
Family Care Cough and Cold liquid US
Family Care Multi Symptom Cold liquid US
Fast Acting Mucus Relief Maximum Strength Severe Cough and Congestion liquid US
Fast Mucus Relief tablet, coated US
Fast Mucus Relief tablet, film coated US
Fast Mucus Relief tablet, film coated US
Fast Mucus Relief Cold Flu and Sore Throat Maximum Strength Multi-Symptom liquid US
Flowtuss liquid US
Flu, Cough & Cold Complete tablet Canada
Formucare Cough Syrup Dm liquid US
Freds Chest Congestion Relief DM tablet US
G Tron syrup US
G-bronco-d suspension US
G-supress Dx syrup US
G-tron PED solution US
G-tron Pediatric Drops solution/ drops US
G-tusicof syrup US
G-tuss-nl liquid US
G-tuss-nl Ped liquid US
G-xpect Pse liquid US
G-zyncof syrup US
Gadavyt Cough liquid US
Gadavyt Cough DM liquid US
Geri-tussin Expectorant liquid US
Gilphex Tr tablet US
Giltuss syrup US
Giltuss Pediatric solution/ drops US
Giltuss Total Release tablet US
Good Neighbor Pharmacy Childrens Mucus Relief liquid US
Good Neighbor Pharmacy Cold multi symptom tablet, film coated US
Good Neighbor Pharmacy Cold severe tablet, coated US
Good Neighbor Pharmacy Day Time liquid US
Good Neighbor Pharmacy Day Time Severe suspension US
Good Neighbor Pharmacy Mucus Er tablet, extended release US
Good Neighbor Pharmacy Mucus Relief tablet US
Good Neighbor Pharmacy Mucus Relief tablet, film coated US
Good Neighbor Pharmacy Mucus Relief cold and sinus tablet, coated US
Good Neighbor Pharmacy Mucus Relief Dm tablet US
Good Neighbor Pharmacy Mucus Relief Pe PE tablet US
Good Neighbor Pharmacy Mucus Relief Severe Cold tablet, film coated US
Good Neighbor Pharmacy Mucus Relief Severe Congestion and Cold tablet, film coated US
Good Neighbor Pharmacy Severe Day Time tablet, film coated US
Good Neighbor Pharmacy Sinus Relief capsule, coated US
Good Neighbor Pharmacy Sinus Relief capsule, coated US
Good Neighbor Pharmacy Tab Tussin Dm DMTDM tablet US
Good Neighbor Pharmacy Tabtussin tablet US
Good Neighbor Pharmacy Tussin syrup US
Good Neighbor Pharmacy Tussin syrup US
Good Neighbor Pharmacy Tussin syrup US
Good Neighbor Pharmacy Tussin Cf liquid US
Good Neighbor Pharmacy Tussin Cf Max liquid US
Good Neighbor Pharmacy Tussin Dm solution US
Good Neighbor Pharmacy Tussin Dm solution US
Good Neighbor Pharmacy Tussin Dm Max suspension US
Good Neighbor Pharmacy Tussin Dm Max adult liquid US
Good Sense Adult Tussin Dm suspension US
Good Sense Childrens Mucus Relief liquid US
Good Sense Childrens Mucus Relief Cough solution US
Good Sense Cold and Flu Severe tablet, coated US
Good Sense Cold Head Congestion severe tablet, coated US
Good Sense Cold multi symptom tablet, film coated US
Good Sense Day Time liquid US
Good Sense Mucus Er tablet, extended release US
Good Sense Mucus Relief liquid US
Good Sense Mucus Relief Cold and Sinus tablet, coated US
Good Sense Mucus Relief cold flu and sore throat tablet, film coated US
Good Sense Mucus Relief Severe Congestion and Cold tablet, film coated US
Good Sense Severe Cold tablet, film coated US
Good Sense Severe Daytime Cold and Flu tablet, film coated US
Good Sense Severe Daytime Cold and Flu solution US
Good Sense Tussin Cf solution US
Good Sense Tussin Cf cough and cold liquid US
Good Sense Tussin Cf cough and cold liquid US
Good Sense Tussin cf max liquid US
Good Sense Tussin chest congestion syrup US
Good Sense Tussin Dm solution US
Good Sense Tussin Dm cough and chest congestion liquid US
Good Sense Tussin Dm cough and chest congestion solution US
Good Sense Tussin dm max liquid US
Good Sense Tussin mucus and chest congestion syrup US
Green Guard Cough and Cold Relief tablet, film coated US
Green Tussin DM liquid US
Green Tussin Sugar Free DM liquid US
Guaap liquid US
Guaiasorb Dm liquid US
Guaiatussin Ac liquid US
Guaifenesin liquid US
Guaifenesin liquid US
Guaifenesin liquid US
Guaifenesin tablet US
Guaifenesin tablet US
Guaifenesin solution US
Guaifenesin solution US
Guaifenesin solution US
Guaifenesin tablet US
Guaifenesin tablet US
Guaifenesin tablet US
Guaifenesin AC syrup US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate solution US
Guaifenesin and Codeine Phosphate SF liquid US
Guaifenesin and Dextromethorphan syrup US
Guaifenesin and Dextromethorphan Hydrobromide liquid US
Guaifenesin Dm tablet US
Guaifenesin Dm syrup US
Guaifenesin Dm solution US
Guaifenesin Dm solution US
Guaifenesin DM syrup US
Guaifenesin Extended Release tablet, extended release US
Guaifenesin Extended Release Extended Release tablet, extended release US
Guaifenesin Phenylephrine Dextromethorphan tablet, coated US
Guaifenesin Syrup Extra Strength 200mg/5ml syrup Canada
Guaifenesine Liq 100mg/5ml liquid Canada
Guaifenesine Liq 100mg/5ml Sans Sucrose liquid Canada
Guaitussin DM Cough Formula Syr syrup Canada
Guaitussin DM Syrup syrup Canada
Guiafenesin tablet US
Guiatuss syrup US
H E B Max Severe Congestion and Cough Maxium Strength liquid US
Harmon Face Values Tussin Cf solution US
Harmon Face Values Tussin Dm Adult solution US
Harris Teeter Tussin solution US
Harris Teeter Tussin solution US
Harris Teeter Tussin suspension US
Head Congestion Cold Daytime tablet, coated US
Head Congestion Cold Relief Severe Non-Drowsy tablet, film coated US
Health Mart Adult Tussin syrup US
Health Mart Adult Tussin solution US
Health Mart Adult Tussin liquid US
Health Mart Adult Tussin solution US
Health Mart Adult Tussin DM liquid US
Health Mart Daytime tablet, film coated US
Health Mart Mucus Er tablet, extended release US
Healthmart Chest Congestion Relief tablet US
Healthmart Chest Congestion Relief Dmdm DM tablet US
Healthmart Mucus Relief Fm tablet US
Healthmart Mucus Relief Fm tablet US
Healthmart Mucus Relief Fm tablet US
Healthy Accents Childrens Mucus Relief solution US
Healthy Accents Cold and Flu tablet, coated US
Healthy Accents Cold Head Congestion daytime non drowsy tablet, coated US
Healthy Accents Mucus Relief tablet, extended release US
Healthy Accents Mucus Relief cold and sinus tablet, coated US
Healthy Accents Mucus Relief cold flu and sore throat tablet, film coated US
Healthy Accents Mucus Relief Severe Cold tablet, film coated US
Healthy Accents Mucus Relief Severe Congestion and Cold tablet, film coated US
Healthy Accents Sinus Relief capsule, coated US
Healthy Accents Tussin syrup US
Healthy Accents Tussin Cf solution US
Healthy Accents Tussin Chest Congestion adult syrup US
Healthy Accents Tussin Dm solution US
Healthy Accents Tussin Dm adult sugar free liquid US
High Blood Pressure Chest Congestion and Cough tablet, film coated US
Histenol Forte Ii tablet US
Histenol II tablet Canada
Hycofenix liquid US
Igualtuss liquid US
Immediate-release Mucus Relief Dm tablet, film coated US
Iophen C Nr liquid US
Iophen Dm Nr solution US
Iophen Nr liquid US
J-max syrup US
Jack & Jill Expectorant syrup Canada
Kids-eeze Chest Relief tablet, orally disintegrating US
Klernaz tablet US
Kmart – Fast Maximum Cold and Sinus solution US
Kmart – Fast Maximum Cold, Flu and Sore Throat Relief solution US
Kmart – Fast Maximum Dm Max solution US
Kmart – Fast Maximum Severe Congestion and Cough solution US
Koffex DM + Decongestant + Expectorant syrup Canada
Koffex DM + Decongestant + Expectorant Extra Strength syrup Canada
Koffex DM + Expectorant syrup Canada
Koffex DM + Expectorant Extra Strength syrup Canada
Koffex DM-d-e – Liq liquid Canada
Koffex Expectorant syrup Canada
Koffex Expectorant Sans Sucrose liquid Canada
Leader Adult Tussin Chest Congestion syrup US
Leader Adult Tussin Dm solution US
Leader Adult Tussin Mucus Plus Chest Congestion syrup US
Leader Chest Congestion Relief G450 tablet US
Leader Chest Congestion Relief PE tablet US
Leader Chest Congestion Relief Plus Dmdm DM tablet US
Leader Childrens Mucus Relief Cough liquid US
Leader Childrens Mucus Relief Multi Symptom Cold liquid US
Leader Cold Head Congestion tablet, coated US
Leader Cough Tabs tablet US
Leader Day Time liquid US
Leader Day Time tablet, film coated US
Leader Intense Cough Reliever liquid US
Leader Mucus Er tablet, extended release US
Leader Mucus Er tablet, extended release US
Leader Mucus Relief tablet, film coated US
Leader Mucus Relief childrens liquid US
Leader Mucus Relief Cold and Sinus tablet, coated US
Leader Mucus Relief Cold Flu and Sore Throat tablet, film coated US
Leader Mucus Relief Severe Congestion and Cold tablet, film coated US
Leader Severe Cold and Flu tablet, coated US
Leader Tabtussin 400 tablet US
Leader Tabtussin 400 tablet US
Leader Tabtussin Dm TDM tablet US
Leader Tussin suspension US
Leader Tussin Cf solution US
Leader Tussin Cf Max liquid US
Leader Tussin Dm liquid US
Leader Tussin Dm Max adult liquid US
Libera Tos liquid US
Libera Tos liquid US
Libera Tos liquid US
Licorice Coughing Liquid liquid US
Lil Drug Store Cold Relief tablet US
Lil Drug Store Cold Relief tablet US
Lil Drug Store Multi-symptom Sinus Relief tablet US
Lil Drug Store Multi-symptom Sinus Relief tablet US
Liqufruta syrup US
Liqufruta syrup US
Liquituss Gg liquid US
Little Remedies Little Colds Mucus Relief Expectorant Melt Aways granule US
Lortuss EX liquid US
Lusair liquid US
M-clear WC liquid US
Mar-cof Cg Expectorant syrup US
Max Cold, Flu, and Sore Throat liquid US
Maximum Strength Mucus Relief Cold and Sinus Max tablet US
Maximum Strength Mucus Relief Cold Flu and Sore Throat tablet US
Maximum Strength Mucus Relief Severe Congestion and Cold tablet, film coated US
Maximum Strength Tussnex Fm Dm Max liquid US
Maximum Strength-cough and Chest Congestion Dm capsule, liquid filled US
Maxiphen tablet US
Maxiphen Dm tablet US
Maxium Strength Dm Max liquid US
Maxium Strength Severe Congestion and Cough Max liquid US
Medi-first Cold Relief tablet, film coated US
Medi-first Plus Cold Relief tablet, film coated US
Medique Ccp Caffeine Free tablet US
Medique Decorel Forte Plus tablet, film coated US
Medique Guaicon Dms syrup US
Moore Medical Moorebrand Severe Cold Relief tablet, film coated US
Mucaphed tablet, coated US
Mucaplex tablet US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex tablet, extended release US
Mucinex D tablet, extended release US
Mucinex D tablet, extended release US
Mucinex D tablet, extended release US
Mucinex D Maximum Strength tablet, extended release US
Mucinex Dm tablet US
Mucinex Dm tablet, extended release US
Mucinex Dm tablet, extended release US
Mucinex Dm tablet, extended release US
Mucinex Dm Maximum Strength tablet, extended release US
Mucinex Extended Release Bi-layer Tablets tablet (immediate and extended release) Canada
Mucinex Fast-max Cold and Sinus liquid US
Mucinex Fast-max Cold and Sinus tablet, coated US
Mucinex Fast-Max Cold, Flu and Sore Throat powder, for solution US
Mucinex Fast-max Cold, Flu and Sore Throat capsule, liquid filled US
Mucinex Fast-max Cold, Flu and Sore Throat solution US
Mucinex Fast-max Cold, Flu and Sore Throat tablet, coated US
Mucinex Fast-max DM Max solution US
Mucinex Fast-max DM Max solution US
Mucinex Fast-Max Severe Cold powder, for solution US
Mucinex Fast-Max Severe Cold solution US
Mucinex Fast-max Severe Cold tablet, coated US
Mucinex Fast-max Severe Congestion and Cold tablet, coated US
Mucinex Fast-max Severe Congestion and Cough solution US
Mucinex Fast-max Severe Congestion and Cough tablet, coated US
Mucinex Maximum Strength tablet, extended release US
Mucinex Multi-action Cold & Sinus Caplets tablet Canada
Mucinex Multi-action Cold & Sinus Liquid liquid Canada
Mucinex Multi-action Cold, Flu & Sore Throat Caplets tablet Canada
Mucinex Multi-action Cold, Flu & Sore Throat Liquid liquid Canada
Mucinex Multi-action Congestion & Cold Caplets tablet Canada
Mucinex Multi-action Congestion, Stuffy Nose & Cough Liquid liquid Canada
Mucinex Multi-action Wet & Dry Cough Liquid liquid Canada
Mucinex Sinus-action Complete Congestion and Sinus Pain tablet Canada
Mucinex Sinus-action Pressure, Pain & Congestion tablet Canada
Mucinex Sinus-max Pressure and Pain liquid US
Mucinex Sinus-max Pressure and Pain tablet, coated US
Mucinex Sinus-max Severe Congestion Relief liquid US
Mucinex Sinus-max Severe Congestion Relief capsule, liquid filled US
Mucinex Sinus-max Severe Congestion Relief tablet, coated US
Mucinex Sinus-max Severe Congestion Relief Maximum Strength tablet, coated US
Mucosa tablet US
Mucosa tablet US
Mucosa Dm tablet US
Mucosa Dm tablet US
Mucous Relief solution Canada
Mucus & Phlegm Relief Extra Strength syrup Canada
Mucus & Phlegm Relief With Cough Control Extra Strength syrup Canada
Mucus and Chest Congestion syrup US
Mucus and Cough Relief tablet US
Mucus and Sinus Pe tablet, coated US
Mucus Dm tablet US
Mucus Er tablet, extended release US
Mucus Er tablet, extended release US
Mucus Er tablet, extended release US
Mucus Er tablet, extended release US
Mucus Er tablet, extended release US
Mucus Er tablet, extended release US
Mucus Er tablet, extended release US
Mucus Extended Release tablet, extended release US
Mucus Releif Expectorant tablet US
Mucus Relief tablet, film coated US
Mucus Relief tablet, extended release US
Mucus Relief tablet, film coated US
Mucus Relief tablet US
Mucus Relief tablet, film coated US
Mucus Relief tablet US
Mucus Relief tablet, extended release US
Mucus Relief tablet, extended release US
Mucus Relief tablet, film coated US
Mucus Relief tablet US
Mucus Relief tablet, extended release US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet, film coated US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief tablet US
Mucus Relief Chest tablet US
Mucus Relief Chest tablet, coated US
Mucus Relief Cold and Sinus tablet, coated US
Mucus Relief cold and sinus tablet, coated US
Mucus Relief cold and sinus tablet, coated US
Mucus Relief Cold and Sinus tablet, coated US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief Cold and Sinus Maximum Strength liquid US
Mucus Relief cold flu and sore throat tablet, film coated US
Mucus Relief Cold Flu and Sore Throat tablet, film coated US
Mucus Relief Cold Flu and Sore Throat tablet, film coated US
Mucus Relief Cold Flu and Sore Throat tablet, coated US
Mucus Relief Cold Flu and Sore Throat Max Maximum Strength tablet, film coated US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold Flu Sore Throat Maximum Strength liquid US
Mucus Relief Cold, Flu and Sore Throat tablet, coated US
Mucus Relief Cold, Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold, Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold, Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold, Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cold, Flu and Sore Throat Maximum Strength liquid US
Mucus Relief Cough tablet US
Mucus Relief Cough and Congestion Dm tablet, coated US
Mucus Relief D tablet, film coated US
Mucus Relief D tablet, film coated US
Mucus Relief D tablet, film coated US
Mucus Relief D Immediate Release tablet US
Mucus Relief D Immediate Release tablet US
Mucus Relief Dm tablet, film coated US
Mucus Relief DM tablet US
Mucus Relief Dm tablet, coated US
Mucus Relief Dm tablet, coated US
Mucus Relief Dm tablet, film coated US
Mucus Relief Dm tablet, film coated US
Mucus Relief Dm tablet, film coated US
Mucus Relief Dm tablet, film coated US
Mucus Relief Dm tablet, coated US
Mucus Relief Dm tablet US
Mucus Relief Dm tablet US
Mucus Relief Dm tablet US
Mucus Relief Dm tablet US
Mucus Relief Dm tablet, film coated US
Mucus Relief Dm capsule, liquid filled US
Mucus Relief DM tablet US
Mucus Relief Dm tablet US
Mucus Relief Dm Expectorant and Cough Suppressant tablet, coated US
Mucus Relief Dm Immediate Release tablet US
Mucus Relief Dm Max Maximum Strength liquid US
Mucus Relief Dm Max Maximum Strength liquid US
Mucus Relief DM Max Maximum Strength liquid US
Mucus Relief Dm Max Maximum Strength liquid US
Mucus Relief Dm Max Maximum Strength liquid US
Mucus Relief Dm Max Maximum Strength Fast Acting liquid US
Mucus Relief Er tablet, extended release US
Mucus Relief Expectorant tablet US
Mucus Relief Immediate Release tablet US
Mucus Relief Immediate Release tablet US
Mucus Relief Maximum Strength tablet, film coated US
Mucus Relief Maximum Strength tablet, film coated US
Mucus Relief MAXIMUM STRENGTH tablet, film coated US
Mucus Relief Maximum Strength tablet, film coated US
Mucus Relief Maximum Strength tablet US
Mucus Relief Maximum Strength tablet US
Mucus Relief Maximum Strength DM Max liquid US
Mucus Relief Maximum Strength Multi Symptom Relief liquid US
Mucus Relief Maximum Strength Severe Congestion and Cough liquid US
Mucus Relief Pe tablet US
Mucus Relief Pe tablet, film coated US
Mucus Relief Pe tablet, film coated US
Mucus Relief Plus tablet, film coated US
Mucus Relief Plus tablet, film coated US
Mucus Relief Severe Cold tablet, film coated US
Mucus Relief Severe Cold tablet, coated US
Mucus Relief Severe Cold tablet, coated US
Mucus Relief Severe Cold Daytime Maximum Strength liquid US
Mucus Relief Severe Congestion and Cold tablet, film coated US
Mucus Relief Severe Congestion and Cold tablet, film coated US
Mucus Relief Severe Congestion and Cold tablet, film coated US
Mucus Relief Severe Congestion and Cold Max Maximum Strength tablet, film coated US
Mucus Relief Severe Congestion and Cough liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength tablet, film coated US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion and Cough Maximum Strength liquid US
Mucus Relief Severe Congestion Cough Maximum Strength liquid US
Mucus Relief Severe Cough and Congestion solution US
Mucus Relief Severe Sinus Congestion Maximum Strength tablet, film coated US
Mucus Relief Sinus tablet US
Mucus Relief Sinus Pressure and Pain tablet, coated US
Mucus Relief Sinus Severe Congestion Relief tablet, coated US
Mucus Relief Sinus Severe Congestion Relief tablet, coated US
Multi Symptom Cold liquid US
Multi Symptom Cold tablet US
Multi Symptom Cold liquid US
Multi Symptom Cold Cf liquid US
Multi Symptom Cold Cf liquid US
Multi Symptom Cold Cf liquid US
Multi Symptom Cold Cf Adult liquid US
Multi Symptom Cold Double Max Power liquid US
Multi Symptom Cold Relief Cf Non Drowsy liquid US
Multi-symptom Cold and Sinus Maximum Strength tablet, film coated US
Multi-symptom Cold Flu and Sore Throat Maximum Strength tablet, film coated US
Multi-symptom Cold Flu and Sore Throat Maximum Strength tablet, film coated US
Multi-symptom Cold Severe, Non-Drowsy, Daytime tablet, film coated US
Neo Tuss Syr syrup Canada
Nezger Tab tablet Canada
Ninjacof-xg liquid US
Nivanex Dmx tablet US
Non Drowsy Cold and Cough Pe capsule, coated US
Non Drowsy Cold and Cough Pe capsule, coated US
Non Drowsy Regular Strength Contac Cold Chest Congestion capsule Canada
Non-drowsy Sinus Congestion and Pain tablet, coated US
Non-drowsy Wal-phed Pe Triple Relief tablet US
Non-drying Sinus Pe tablet, film coated US
Novahistex Dh Expectorant syrup Canada
Novahistex DM Expectorant With Decongestant liquid Canada
Novahistex Expectorant With Decongestant liquid Canada
Novahistine DM Expectorant With Decongestant liquid Canada
Nu-copd tablet US
Obredon solution US
Organ I Nr tablet US
Organ-i Nr tablet US
Organ-i Nr tablet US
Organ-i Nr tablet US
Organ-i Nr tablet US
Organ-i Nr tablet US
Ornade Expectorant Cough Formula liquid Canada
Pancold S Oral liquid US
Panto A liquid US
Pe Multi-stymptom Cold and Cough Relief capsule, coated US
Pecgen Dmx syrup US
Pecgen Dmx solution US
Pecgen Pse Cough Suppressant Expectorant Nasal Decongestant Grape Flavor liquid US
Pediacare Childrens Cough and Congestion liquid US
Pharmitussin DM syrup Canada
Physicianscare Cold and Cough Non-Drowsy tablet, film coated US
Physicianscare Cold and Cough Non-Drowsy tablet, film coated US
Poly-vent Dm tablet US
Poly-vent Ir tablet US
Preferred Plus Chest Congestion Relief tablet US
Preferred Plus Chest Congestion Relief Dmtdm TDM tablet US
Preferred Plus Chest Congestion Relief PE tablet US
Preferred Plus Childrens Mucus Relief Multi Symptom Cold solution US
Preferred Plus Day Time Cold and Flu tablet, film coated US
Preferred Plus Intense Cough Reliever liquid US
Preferred Plus Mucus Er tablet, extended release US
Preferred Plus Mucus Relief tablet, film coated US
Preferred Plus Mucus Relief Cold and Sinus tablet, coated US
Preferred Plus Severe Cold tablet, film coated US
Preferred Plus Severe Day Time suspension US
Preferred Plus Sinus Relief capsule, coated US
Preferred Plus Sinus Relief capsule, coated US
Preferred Plus Tabtussin tablet US
Preferred Plus Tabtussin Dm DMTDM tablet US
Premier Value Chest and Sinus Congestion Relief tablet US
Premier Value Chest Congestion and Cough Releif DM tablet US
Premier Value Chest Congestion Relief tablet US
Presgen syrup US
Presgen Pediatric syrup US
Pressure and Pain Pe Plus Cold tablet, coated US
Pressure and Pain Pe Plus Mucus tablet, coated US
Pressure Pain Cold Pe tablet, coated US
Pressure Pain Mucus Pe tablet, coated US
Pressure Plus Pain Pe Plus Cold tablet, coated US
Prime’s Sore Throat, Cough and Colds Capsules capsule Canada
Pulmorex Expectorant Liq syrup Canada
Pulmovac liquid US
Q Tussin Dm syrup US
Q Tussin Dm syrup US
Q Tussin Dm syrup US
Q Tussin Dm syrup US
Q Tussin Dm syrup US
Q-tussin solution US
Qtussin solution US
Qtussin solution US
Quality Choice Mucus Relief tablet US
Quality Choice Mucus Relief Dm DM tablet US
Quality Choice Mucus Relief Pe PE tablet US
Ratio-cotridin Expectorant syrup Canada
Reese Onetab Congestion and Cough tablet US
Refenesen syrup US
Refenesen Chest Congestion Relief tablet US
Refenesen Chest Congestion Relief PE tablet US
Refenesen Chest Congestion Relief pe tablet US
Regular Strength Mucous Relief Chest tablet Canada
Regular Strength Tylenol Cold Chest Congestion tablet Canada
Relcof-c liquid US
Rescon Gg liquid US
Respaire-30 capsule US
Rexall Dm Cough and Congestion Relief solution US
Ritussin Dm liquid US
Ritussin Expectorant liquid US
Robafen solution US
Robafen Ac syrup US
Robafen Cf Cough and Cold solution US
Robafen Cough Formula syrup US
Robafen Cough Formula syrup US
Robafen Dm Cough Sugar Free Clear solution US
Robafen Dm Max Non drowsy liquid US
Robitussin Cough & Cold Extra Strength syrup Canada
Robitussin Cough and Cold syrup Canada
Robitussin Cough and Cold Liqui-gels capsule Canada
Robitussin Cough Control liquid Canada
Robitussin Cough Control Extra Strength liquid Canada
Robitussin Cough Control for People With Diabetes liquid Canada
Robitussin Cough, Cold & Flu Liqui-gels capsule Canada
Robitussin Maximum Strength Cough Plus Chest Congestion Dm capsule, liquid filled US
Robitussin Mucus & Phlegm syrup Canada
Robitussin Mucus & Phlegm Extra Strength syrup Canada
Robitussin Mucus Plus Chest Congestion liquid US
Robitussin Peak Cold Cough Plus Chest Congestion Dm liquid US
Robitussin Peak Cold Maximum Strength Cough Plus Chest Congestion Dm solution US
Robitussin Peak Cold Maximum Strength Multi-symptom Cold liquid US
Robitussin Peak Cold Multi-symptom Cold liquid US
Robitussin Peak Cold Sugar-free Cough Plus Chest Congestion Dm liquid US
Robitussin Severe Multi-symptom Cough Cold Flu liquid US
Robitussin To Go Cough and Chest Congestion Dm liquid US
Robitussin To Go Cough and Cold Cf solution US
Rompe Pecho liquid US
Rompe Pecho CF liquid US
Rompe Pecho DM liquid US
Rompe Pecho EX liquid US
Rompe Pecho Max Multi Symptoms liquid US
Rompe Pecho SF liquid US
Rugby Mucus Er tablet, extended release US
Rx Act Tussin Cf Cough and Cold solution US
Rx Act Tussin Chest Congestion syrup US
Safetussin DM liquid US
Safetussin DM liquid US
Sanatos Childrens Mucus Relief Cough liquid US
Scot-tussin Expectorant Sf Cough liquid US
Scot-tussin Senior Sf Dmexp liquid US
Select Brand Coughtab 400 tablet US
Select Brand Mucus Relief tablet US
Select Brand Mucus Relief DM tablet US
Select Brand Mucus Relief PE tablet US
Select Brand Tab Tussin tablet US
Select Brand Tab Tussin DM tablet US
Selecthealth Tussin Dm liquid US
Severe Cold tablet, coated US
Severe Cold tablet, coated US
Severe Cold and Flu solution US
Severe Cold and Flu tablet, coated US
Severe Cold and Flu tablet, coated US
Severe Cold and Flu tablet, film coated US
Severe Cold and Flu tablet, coated US
Severe Cold and Flu tablet, coated US
Severe Cold and Flu tablet, coated US
Severe Cold and Flu tablet, film coated US
Severe Cold and Flu suspension US
Severe Cold and Flu daytime tablet, film coated US
Severe Cold and Flu Relief tablet, film coated US
Severe Cold Daytime Multi-Symptom Non-Drowsy tablet, coated US
Severe Cold Head Congestion tablet, coated US
Severe Cold multi symptom tablet, film coated US
Severe Cold Multi Symptom tablet, coated US
Severe Cold Multi Symptom liquid US
Severe Cold Multi-symptom tablet, coated US
Severe Cold Relief tablet, film coated US
Severe Congestion and Cold Maximum Strength tablet, film coated US
Severe Congestion and Cough Max Maxium Strength liquid US
Severe Congestion and Cough Multi-Symptom Maximum Strength tablet, film coated US
Severe Congestion Relief Maximum Strength Sinus tablet, film coated US
Severe Daytime solution US
Severe Daytime tablet, film coated US
Severe Multi-symptom Cold tablet, coated US
Severe Sinus tablet, coated US
Severe Sinus Congestion tablet US
Severe Sinus Congestion and Pain tablet, coated US
Severe Sinus Congestion and Pain tablet, coated US
Severe Sinus Congestion and Pain Daytime tablet, coated US
Severe Sinus Congestion and Pain Daytime tablet, film coated US
Severe Sinus Congestion and Pain Non-Drowsy, Daytime tablet, coated US
Severe Sinus Congestion Relief tablet US
Severe Sinus Congestion Relief Maximum Strength tablet, film coated US
Severe Sinus Pain and Congestion Daytime tablet, film coated US
Shopko Chest Congestion Relief tablet US
Shopko Chest Congestion Relief Dmtdm TDM tablet US
Shoprite Adult Tussin liquid US
Shoprite Adult Tussin syrup US
Shoprite Adult Tussin liquid US
Shoprite Adult Tussin solution US
Shoprite Adult Tussin liquid US
Shoprite Day Calm Severe tablet, film coated US
Shoprite Day Calm Severe solution US
Shoprite Mucus Relief tablet, extended release US
Shoprite Severe Cold tablet, film coated US
Signature Care Mucus Relief tablet, extended release US
Signature Care Tussin suspension US
Siltussin Das liquid US
Siltussin Dm liquid US
Siltussin Dm liquid US
Siltussin Dm liquid US
Siltussin Dm Das Cough Formula liquid US
Siltussin Sa liquid US
Siltussin Sa liquid US
Siltussin Sa liquid US
Simpex Guaifenesin tablet US
Simply Right Mucus Relief tablet, extended release US
Sinus Congestion and Pain tablet, coated US
Sinus Congestion and Pain Daytime Non-Drowsy Severe tablet US
Sinus Congestion and Pain Relief tablet, coated US
Sinus Congestion and Pain Relief Non-Drowsy/Daytime tablet, film coated US
Sinus Congestion and Pain Severe tablet, film coated US
Sinus Congestion and Pain Severe tablet, film coated US
Sinus Congestion and Pain Severe tablet, coated US
Sinus Congestion and Pain Severe tablet, coated US
Sinus Congestion and Pain Severe tablet, film coated US
Sinus Congestion and Pain Severe tablet, coated US
Sinus Congestion and Pain Severe tablet, coated US
Sinus Congestion and Pain Severe tablet, coated US
Sinus Congestion Pe tablet US
Sinus Congestion Pe tablet US
Sinus Medication tablet Canada
Sinus Pe Pressure, Pain and Cold Daytime tablet, film coated US
Sinus Pressure and Pain maximum strength tablet, film coated US
Sinus Pressure and Pain Relief extra strength tablet US
Sinus Relief capsule, coated US
Sinus Relief capsule, coated US
Sinus Relief capsule, coated US
Sinus Relief Maximum Strength tablet, film coated US
Sinus Relief Pe Maxium Strength tablet US
Sinus Relief Severe Congestion tablet US
Sinus Relief Severe Congestion Maximum Strength tablet, film coated US
Sinus Relief Severe Congestion Maximum Strength liquid US
Sirop DM Expectorant syrup Canada
Sirop Expectorant syrup Canada
Skopko Chest Congestion Relief Pe PE tablet US
Smart Sense Adult Tussin Dm sugar free liquid US
Smart Sense Adults Tussin Cf multi symptom cold solution US
Smart Sense Chest Congestion tablet, extended release US
Smart Sense Childrens Mucus Relief liquid US
Smart Sense Cough and Chest Congestion solution US
Smart Sense Daytime liquid US
Smart Sense Daytime Cold and Flu tablet, film coated US
Smart Sense Mucus Er tablet, extended release US
Smart Sense Mucus Relief Cough Childrens liquid US
Smart Sense Tussin adult syrup US
Smart Sense Tussin Cf adult liquid US
Smart Sense Tussin Dm liquid US
Smart Sense Tussin Dm Max adult liquid US
Sohmed Cold Relief tablet US
Sohmed Sinus tablet US
Sorbugen syrup US
Sound Body Mucus Relief tablet, extended release US
Stona Cough syrup US
Stona Cough tablet US
Sudafed Cold and Flu Gel Caps capsule Canada
Sudafed Pe Cold and Flu Caplets tablet Canada
Sudafed Pe Pressure Plus Pain Plus Cold tablet, film coated US
Sudafed Pe Pressure Plus Pain Plus Mucus tablet, film coated US
Sudafed Pe Total tablet Canada
Sudafed Total Cold and Flu Rapid Release tablet Canada
Sun Mark Mucus Relief Cough Childrens solution US
Sun Mark Tussin Dm cough and chest congestion liquid US
Sunmark Adult Tussin DM liquid US
Sunmark Chest Congestion Relief Dm DM tablet US
Sunmark Chest Congestion Relief Pe PE tablet US
Sunmark Cold and Flu Severe tablet, coated US
Sunmark Cold Head Congestion tablet, coated US
Sunmark Mucus Er tablet, extended release US
Sunmark Tussin syrup US
Sunmark Tussin Cf solution US
Sunmark Tussin chest congestion syrup US
Sunmark Tussin Dm sugar free solution US
Supress Dm syrup US
Supress Dx Pediatric Drops syrup US
Supress-pe Pediatric solution/ drops US
Syrup DM-d-e syrup Canada
Syrup DM-e syrup Canada
The Medicine Shoppe Chest Congestion Relief tablet US
Theraflu Flu and Chest Congestion powder, for solution US
Theraflu Max-D powder, for solution US
Theraflu Warming Relief Cold and Chest Congestion syrup US
Topcare Childrens Mucus Relief Multi Symptom Cold solution US
Topcare Cold tablet, coated US
Topcare Cold and Flu tablet, coated US
Topcare Cold Head Congestion Severe tablet, coated US
Topcare Cold Multi Symptom Severe tablet, film coated US
Topcare Day Time Cold and Flu suspension US
Topcare Day Time Cold and Flu Severe tablet, film coated US
Topcare Mucus Er tablet, extended release US
Topcare Mucus Relief solution US
Topcare Mucus Relief liquid US
Topcare Mucus Relief cold and sinus tablet, coated US
Topcare Mucus Relief Cold Flu and Sore Throat tablet, film coated US
Topcare Mucus Relief Severe Congestion and Cold tablet, film coated US
Topcare Sinus Relief capsule, coated US
Topcare Sinus Relief Pressure and Pain capsule, coated US
Topcare Tussin Cf solution US
Topcare Tussin Cf Max suspension US
Topcare Tussin Chest Congestion syrup US
Topcare Tussin Dm solution US
Topcare Tussin Dm Max suspension US
Topcare Tussin Dm sugar free cough and chest congestion solution US
Topcare Tussin mucus plus chest congestion syrup US
Total Cold and Flu syrup Canada
Total Cold and Flu tablet Canada
Total Cold and Flu Extra Strength syrup Canada
Triaminic Chest and Nasal Congestion liquid Canada
Triaminic Chest and Nasal Congestion syrup US
Triaminic Cough and Congestion liquid US
Triaminic Decongest+expect Liqui-gels Cap capsule Canada
Triaminic DM Daytime Syr syrup Canada
Triaminic DM Expectorant Syr syrup Canada
Triaminic Expectorant Syr syrup Canada
Tricode GF liquid US
Trispec Dmx Cough Suppressant Expectorant Cherry Raspberry Flavor liquid US
Trispec Dmx Pediatric Drops Cough Suppressant Expectorant Cherry Raspberry Flavor liquid US
Trispec Pse Cough Suppressant Expectorant Nasal Decongestant Grape Flavor liquid US
Trispec Pse Pediatric Drops Cough Suppressant Expectorant Nasal Decongestant Grape Flavor liquid US
Tukol A liquid US
Tukol Maxium Strength Cough and Mucus Relief capsule, gelatin coated US
Tukol Multi Symptom Cold liquid US
Tukol X-pecto Miel Multi Symptom Cold liquid US
Tusicof syrup US
Tusicof tablet, coated US
Tusnel liquid US
Tusnel tablet US
Tusnel C liquid US
Tusnel Diabetic liquid US
Tusnel Dm Pediatric solution/ drops US
Tusnel Pediatric liquid US
Tusnel Pediatric solution/ drops US
Tussi Pres syrup US
Tussi Pres syrup US
Tussi Pres Pediatric syrup US
Tussin solution US
Tussin solution US
Tussin solution US
Tussin liquid US
Tussin syrup US
Tussin adult solution US
Tussin Adult chest congestion syrup US
Tussin adult chest congestion syrup US
Tussin adult chest congestion syrup US
Tussin adult mucus and chest congestion liquid US
Tussin adults non drowsy syrup US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf solution US
Tussin Cf liquid US
Tussin Cf liquid US
Tussin Cf Adult liquid US
Tussin Cf Adult Cough and Cold solution US
Tussin Cf Adult Maximum Strength liquid US
Tussin Cf Adult Multi Symptom Cold liquid US
Tussin Cf Adult Non Drowsy solution US
Tussin Cf Cough and Cold solution US
Tussin Cf Dextromethorphan HBr, Guaifenesin, Phenylephrine HCL liquid US
Tussin Cf Max liquid US
Tussin Cf Maximum Strength liquid US
Tussin Cf Maximum Strength liquid US
Tussin Cf Maximum Strength liquid US
Tussin Cf Multi Symptom Cold Adult liquid US
Tussin Cf Multi-symptom Cold liquid US
Tussin Cf non drowsy solution US
Tussin Cf Non Drowsy liquid US
Tussin Cf Non Drowsy Multi Symptom liquid US
Tussin Chest liquid US
Tussin Chest Congestion liquid US
Tussin Chest Congestion Adult Non Drowsy syrup US
Tussin Chest Congestion Non Drowsy liquid US
Tussin Cough adult maximum strength liquid US
Tussin Cough and Chest Congestion Dm liquid US
Tussin Cough and Chest Congestion Dm liquid US
Tussin Cough and Chest Congestion Dm liquid US
Tussin Cough and Chest Congestion Dm Adult liquid US
Tussin Cough and Chest Congestion Dm Adult liquid US
Tussin Cough and Chest Congestion Dm Sugar Free liquid US
Tussin Cough Dm adult liquid US
Tussin Cough Dm Adult Sugar Free liquid US
Tussin Cough EXPECTORANT COUGH SUPRESSANT DM liquid US
Tussin Cough Medicine DM Antitussive Expectorant Decongestant liquid Canada
Tussin Cough Medicine Gf Expectorant liquid Canada
Tussin Dm solution US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm solution US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm suspension US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm solution US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm liquid US
Tussin Dm solution US
Tussin Dm Adult liquid US
Tussin Dm Adult solution US
Tussin Dm adult solution US
Tussin Dm adult cough and chest congestion liquid US
Tussin Dm Adult cough and chest congestion solution US
Tussin Dm adults solution US
Tussin Dm Cough and Chest Congestion liquid US
Tussin Dm Cough and Chest Congestion liquid US
Tussin Dm Cough and Chest Congestion liquid US
Tussin Dm Cough and Chest Congestion Adult liquid US
Tussin Dm Cough and Chest Congestion Non Drowsy liquid US
Tussin Dm Cough and Chest Congestion sugar-free ReadyInCase liquid US
Tussin Dm Cough and Chest Non Drowsy liquid US
Tussin Dm COUGH SUPPRESSANT/EXPECTORANT liquid US
Tussin Dm COUGH SUPPRESSANT/EXPECTORANT liquid US
Tussin Dm Max adult cough and chest congestion solution US
Tussin Dm Max Adult Cough Plus Chest Congestion liquid US
Tussin Dm Max non drowsy suspension US
Tussin Dm Sugar Free liquid US
Tussin Dm Sugar Free Non Drowsy liquid US
Tussin Dmmaximum Strength liquid US
Tussin EXPECTORANT liquid US
Tussin expectorant for adults syrup US
Tussin maximum strength suspension US
Tussin Mucus and Chest Congestion syrup US
Tussin Mucus and Chest Congestion Adult liquid US
Tussin Mucus and Chest Congestion Adult liquid US
Tussin mucus plus chest congestion syrup US
Tussin multi symptom solution US
Tussin Multi Symptom Cold CF liquid US
Tussin Multi Symptom Cold Cf Adult liquid US
Tussin Multi Symptom Cold Cf Adult liquid US
Tussin Multi Symptom Cold Cf Adult liquid US
Tussin Non Drowsy liquid US
Tussin Original liquid US
Tussin Original liquid US
Tussin Original liquid US
Tussin Original liquid US
Tussin Original liquid US
Tussin Original liquid US
Tussin Peak Cold Sugar-free Cough Plus Chest Congestion Dm liquid US
Tussin Sugar Free liquid US
Tussin Sugar Free Cough liquid US
Tussin Sugar Free Cough liquid US
Tussin Sugar Free Cough liquid US
Tussin Sugar Free Cough liquid US
Tussin Sugar Free Cough liquid US
Tussin Sugar Free Cough liquid US
Tussin Sugar Free Cough liquid US
Tusslin syrup US
Tusslin Pediatric solution/ drops US
Tusslin Tr tablet US
Tussnex Fm Cold and Sinus liquid US
Tussnex Fm Cold, Flu and Sore Throat liquid US
Tussnex Fm Severe Cough and Congestion liquid US
Tylenol Cold and Flu Severe liquid US
Tylenol Cold Head Congestion Severe tablet, film coated US
Tylenol Cold Multi-Symptom Severe liquid US
Tylenol Cold Plus Flu Severe tablet, film coated US
Tylenol Complete Cold, Cough & Flu capsule Canada
Tylenol Sinus Congestion and Pain Severe tablet, film coated US
Tylenol Sinus Plus Mucous Relief tablet Canada
Tylenol Sinus Severe tablet, coated US
Ultra Strength Neocitran Flu Day With Mucus Relief powder for solution Canada
Ultra Tuss syrup US
Ultra Tuss Dm syrup US
Ultra Tuss Safe syrup US
Up and Up Adult Cough and Cold liquid US
Up and Up Adult Cough Formula Dm Max liquid US
Up and Up Adult Cough Formula Dm Non drowsy liquid US
Up and Up Childrens Mucus Relief liquid US
Up and Up Childrens Mucus Relief and Cough liquid US
Up and Up Dm Max cough plus chest congestion suspension US
Up and Up Fast Mucus Relief Severe Cold tablet, film coated US
Up and Up Mucus Relief tablet, extended release US
Up and Up Mucus Relief tablet, film coated US
Up and Up Mucus Relief Cold and Sinus tablet, coated US
Up and Up Mucus Relief Cold Flu and Sore Throat tablet, film coated US
Up and Up Mucus Relief Severe Congestion and Cold tablet, film coated US
Up and Up Sever Cold and Flu daytime solution US
Up and Up Tussin Multi Symptom Cold maximum strength liquid US
Vanacof Dm liquid US
Vasofrinic Plus Sirop syrup Canada
Vicks Chest Congestion Relief syrup Canada
Vicks Custom Care Chest Congestion/cough liquid Canada
Vicks Dayquil Complete Cold & Flu Caplets tablet Canada
Vicks Dayquil Complete Cold & Flu Liquid liquid Canada
Vicks Dayquil Cough Cough & Congestion liquid Canada
Vicks Dayquil Mucus Control liquid Canada
Vicks Dayquil Mucus Control DM liquid US
Vicks Dayquil Severe Cold and Flu solution US
Vicks Dayquil Severe Cold and Flu tablet US
Vicks Dayquil Severe Cold and Flu tablet US
Vicks Pediatric Formula 44e Liq liquid Canada
Virtussin A/c liquid US
Virtussin Ac liquid US
Virtussin Ac liquid US
Virtussin Ac liquid US
Virtussin Dac liquid US
Virtussin Dac liquid US
Viva Cold & Flu All In One Relief Caplets tablet Canada
Wal Tussin liquid US
Wal Tussin adult chest congestion syrup US
Wal Tussin Adult Cough and Cold liquid US
Wal Tussin Cf cough and cold solution US
Wal Tussin Cf Max liquid US
Wal Tussin cough and chest congestion liquid US
Wal Tussin Dm solution US
Wal Tussin Dm adult cough and chest congestion solution US
Wal Tussin Dm Max suspension US
Wal Tussin Dm Max cough and chest congestion suspension US
Wal-phed Pe Multi Symptom tablet, film coated US
Wal-phed Pe Non-drying Sinus tablet US
Walgreens Severe Cold Multi-symptom For Adults liquid US
Walgreens Severe Warming Cold and Flu For Adults liquid US
Z-tuss E liquid US
Zicam liquid US
Zicam Multi-symptom Cold & Flu Daytime liquid Canada
Zodryl Dec 25 suspension US
Zodryl Dec 30 suspension US
Zodryl Dec 40 suspension US
Zodryl Dec 50 suspension US
Zodryl Dec 60 suspension US
Zodryl Dec 80 suspension US
Zyncof syrup US
Zyncof tablet US
Zyncof tablet US

Food Interactions

  • Take with a full glass of water., Take without regard to meals.

Calculated Property

kind Value Source
logP 0.76 ALOGPS
logS -1.1 ALOGPS
Water Solubility 1.49e+01 g/l ALOGPS
logP 0.34 ChemAxon
IUPAC Name 3-(2-methoxyphenoxy)propane-1,2-diol ChemAxon
Traditional IUPAC Name guaifenesin ChemAxon
Molecular Weight 198.2158 ChemAxon
Monoisotopic Weight 198.089208936 ChemAxon
SMILES COC1=CC=CC=C1OCC(O)CO ChemAxon
Molecular Formula C10H14O4 ChemAxon
InChI InChI=1S/C10H14O4/c1-13-9-4-2-3-5-10(9)14-7-8(12)6-11/h2-5,8,11-12H,6-7H2,1H3 ChemAxon
InChIKey InChIKey=HSRJKNPTNIJEKV-UHFFFAOYSA-N ChemAxon
Polar Surface Area (PSA) 58.92 ChemAxon
Refractivity 51.24 ChemAxon
Polarizability 20.59 ChemAxon
Rotatable Bond Count 5 ChemAxon
H Bond Acceptor Count 4 ChemAxon
H Bond Donor Count 2 ChemAxon
pKa (strongest acidic) 13.62 ChemAxon
pKa (strongest basic) -3 ChemAxon
Physiological Charge 0 ChemAxon
Number of Rings 1 ChemAxon
Bioavailability 1 ChemAxon
Rule of Five 1 ChemAxon
Ghose Filter 1 ChemAxon
MDDR-Like Rule 0 ChemAxon

Affected organism

Humans and other mammals